C29H27N5O5S — CID 123307770
1-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea (PubChem CID 123307770) has the molecular formula C29H27N5O5S and a molecular weight of 557.63 g/mol. Its IUPAC name is 1-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea.
| Compound Name | 1-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea |
|---|---|
| PubChem CID | 123307770 |
| Molecular Formula | C29H27N5O5S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 1-[3-[2-(4-benzoyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(NC(=O)Nc3ccc(SO)cc3)cccc12 |
| InChI | InChI=1S/C29H27N5O5S/c1-18-17-33(27(36)19-6-3-2-4-7-19)14-15-34(18)28(37)26(35)23-16-30-25-22(23)8-5-9-24(25)32-29(38)31-20-10-12-21(40-39)13-11-20/h2-13,16,18,30,39H,14-15,17H2,1H3,(H2,31,32,38) |
| InChIKey | HVKNDERRTRAWRI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|