About 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol
18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol (PubChem CID 123307851) has the molecular formula C43H74O3Si
and a molecular weight of 667.15 g/mol. Its IUPAC name is 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol.
Molecular Properties
| Compound Name | 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol |
| PubChem CID | 123307851 |
| Molecular Formula | C43H74O3Si |
| Molecular Weight | 667.15 g/mol |
| Exact Mass | 666.54 |
| IUPAC Name | 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol |
| SMILES | CCCCCCCCCC(CCCCCCCCC(O)C(O)CCCCCCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H74O3Si/c1-6-8-10-12-13-17-22-30-38(31-23-18-14-15-19-29-37-42(45)41(44)36-28-16-11-9-7-2)46-47(43(3,4)5,39-32-24-20-25-33-39)40-34-26-21-27-35-40/h20-21,24-27,32-35,38,41-42,44-45H,6-19,22-23,28-31,36-37H2,1-5H3 |
| InChIKey | FJFUYQGZCOHZGT-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 667.15 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol?
The IUPAC name of 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol (CID 123307851) is 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol.
What is the SMILES notation for 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol?
The canonical SMILES for 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol is CCCCCCCCCC(CCCCCCCCC(O)C(O)CCCCCCC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol?
The InChIKey is FJFUYQGZCOHZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H74O3Si/c1-6-8-10-12-13-17-22-30-38(31-23-18-14-15-19-29-37-42(45)41(44)36-28-16-11-9-7-2)46-47(43(3,4)5,39-32-24-20-25-33-39)40-34-26-21-27-35-40/h20-21,24-27,32-35,38,41-42,44-45H,6-19,22-23,28-31,36-37H2,1-5H3.
What are the key properties of 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol?
18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol has a molecular weight of 667.15 g/mol, XLogP of 11.28, 28 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 18-[tert-butyl(diphenyl)silyl]oxyheptacosane-8,9-diol is sourced from PubChem (CID 123307851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).