C34H40F2N8O4 — CID 123308051
N-[4-[5-[(4-aminopiperidin-1-yl)methyl]-4-[2-fluoro-4-[[2-(4-fluorophenyl)acetyl]carbamoylamino]phenoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]prop-2-enamide (PubChem CID 123308051) has the molecular formula C34H40F2N8O4 and a molecular weight of 662.74 g/mol. Its IUPAC name is N-[4-[5-[(4-aminopiperidin-1-yl)methyl]-4-[2-fluoro-4-[[2-(4-fluorophenyl)acetyl]carbamoylamino]phenoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]prop-2-enamide.
| Compound Name | N-[4-[5-[(4-aminopiperidin-1-yl)methyl]-4-[2-fluoro-4-[[2-(4-fluorophenyl)acetyl]carbamoylamino]phenoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 123308051 |
| Molecular Formula | C34H40F2N8O4 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | N-[4-[5-[(4-aminopiperidin-1-yl)methyl]-4-[2-fluoro-4-[[2-(4-fluorophenyl)acetyl]carbamoylamino]phenoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCCC1CC(CN2CCC(N)CC2)=C2C(Oc3ccc(NC(=O)NC(=O)Cc4ccc(F)cc4)cc3F)=NC=NN21 |
| InChI | InChI=1S/C34H40F2N8O4/c1-2-30(45)38-14-4-3-5-27-18-23(20-43-15-12-25(37)13-16-43)32-33(39-21-40-44(27)32)48-29-11-10-26(19-28(29)36)41-34(47)42-31(46)17-22-6-8-24(35)9-7-22/h2,6-11,19,21,25,27H,1,3-5,12-18,20,37H2,(H,38,45)(H2,41,42,46,47) |
| InChIKey | WKBVLEIPVSVPSR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|