About ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate
ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate (PubChem CID 123308222) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate |
| PubChem CID | 123308222 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate |
| SMILES | CCOC(=O)C1=CN=CCCC1=O |
| InChI | InChI=1S/C9H11NO3/c1-2-13-9(12)7-6-10-5-3-4-8(7)11/h5-6H,2-4H2,1H3 |
| InChIKey | RULJQOMIEJPBTI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate?
The IUPAC name of ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate (CID 123308222) is ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate.
What is the SMILES notation for ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate?
The canonical SMILES for ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate is CCOC(=O)C1=CN=CCCC1=O.
What is the InChIKey of ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate?
The InChIKey is RULJQOMIEJPBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-2-13-9(12)7-6-10-5-3-4-8(7)11/h5-6H,2-4H2,1H3.
What are the key properties of ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate?
ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate has a molecular weight of 181.19 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-oxo-3,4-dihydroazepine-6-carboxylate is sourced from PubChem (CID 123308222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).