About 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine
4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine (PubChem CID 123308564) has the molecular formula C10H10N2S2
and a molecular weight of 222.34 g/mol. Its IUPAC name is 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine.
Molecular Properties
| Compound Name | 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine |
| PubChem CID | 123308564 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine |
| SMILES | Nc1cc2c(s1)Cc1cc(N)sc1C2 |
| InChI | InChI=1S/C10H10N2S2/c11-9-3-5-1-7-6(2-8(5)14-9)4-10(12)13-7/h3-4H,1-2,11-12H2 |
| InChIKey | ZILDICMFSLOPAN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine?
The IUPAC name of 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine (CID 123308564) is 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine.
What is the SMILES notation for 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine?
The canonical SMILES for 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine is Nc1cc2c(s1)Cc1cc(N)sc1C2.
What is the InChIKey of 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine?
The InChIKey is ZILDICMFSLOPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S2/c11-9-3-5-1-7-6(2-8(5)14-9)4-10(12)13-7/h3-4H,1-2,11-12H2.
What are the key properties of 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine?
4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine has a molecular weight of 222.34 g/mol, XLogP of 2.47, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dihydrothieno[2,3-f][1]benzothiole-2,6-diamine is sourced from PubChem (CID 123308564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).