About 4,5-dihydropyrido[3,4-b]azocin-9-ium
4,5-dihydropyrido[3,4-b]azocin-9-ium (PubChem CID 123308885) has the molecular formula C10H11N2+
and a molecular weight of 159.21 g/mol. Its IUPAC name is 4,5-dihydropyrido[3,4-b]azocin-9-ium.
Molecular Properties
| Compound Name | 4,5-dihydropyrido[3,4-b]azocin-9-ium |
| PubChem CID | 123308885 |
| Molecular Formula | C10H11N2+ |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 4,5-dihydropyrido[3,4-b]azocin-9-ium |
| SMILES | C1=C/N=c2/c[nH+]ccc2=CCC1 |
| InChI | InChI=1S/C10H10N2/c1-2-4-9-5-7-11-8-10(9)12-6-3-1/h3-8H,1-2H2/p+1/b6-3?,9-4?,12-10- |
| InChIKey | UMSUXKQXOSLMBC-JXPNSLIVSA-O |
| XLogP | 0.21 |
| TPSA | 26.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dihydropyrido[3,4-b]azocin-9-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydropyrido[3,4-b]azocin-9-ium?
The IUPAC name of 4,5-dihydropyrido[3,4-b]azocin-9-ium (CID 123308885) is 4,5-dihydropyrido[3,4-b]azocin-9-ium.
What is the SMILES notation for 4,5-dihydropyrido[3,4-b]azocin-9-ium?
The canonical SMILES for 4,5-dihydropyrido[3,4-b]azocin-9-ium is C1=C/N=c2/c[nH+]ccc2=CCC1.
What is the InChIKey of 4,5-dihydropyrido[3,4-b]azocin-9-ium?
The InChIKey is UMSUXKQXOSLMBC-JXPNSLIVSA-O. The full InChI is InChI=1S/C10H10N2/c1-2-4-9-5-7-11-8-10(9)12-6-3-1/h3-8H,1-2H2/p+1/b6-3?,9-4?,12-10-.
What are the key properties of 4,5-dihydropyrido[3,4-b]azocin-9-ium?
4,5-dihydropyrido[3,4-b]azocin-9-ium has a molecular weight of 159.21 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydropyrido[3,4-b]azocin-9-ium is sourced from PubChem (CID 123308885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).