C21H24N6O4S — CID 123309034
[3-[[5-(1-benzylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 123309034) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is [3-[[5-(1-benzylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [3-[[5-(1-benzylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 123309034 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [3-[[5-(1-benzylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCC1CCC(Nc2ncncc2C(=O)c2ccn(Cc3ccccc3)n2)C1 |
| InChI | InChI=1S/C21H24N6O4S/c22-32(29,30)31-13-16-6-7-17(10-16)25-21-18(11-23-14-24-21)20(28)19-8-9-27(26-19)12-15-4-2-1-3-5-15/h1-5,8-9,11,14,16-17H,6-7,10,12-13H2,(H2,22,29,30)(H,23,24,25) |
| InChIKey | NEVJVFPWIQWTSI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |