C46H39N7O2 — CID 123309067
3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propan-1-amine (PubChem CID 123309067) has the molecular formula C46H39N7O2 and a molecular weight of 721.87 g/mol. Its IUPAC name is 3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propan-1-amine.
| Compound Name | 3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 123309067 |
| Molecular Formula | C46H39N7O2 |
| Molecular Weight | 721.87 g/mol |
| Exact Mass | 721.32 |
| IUPAC Name | 3-[4-[15-(4-methoxyphenyl)-10,20-dipyridin-4-yl-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propan-1-amine |
| SMILES | COc1ccc(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3ccc(OCCCN)cc3)=c3ccc([nH]3)=C(c3ccncc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C46H39N7O2/c1-54-33-7-3-29(4-8-33)43-35-11-15-39(50-35)45(31-19-24-48-25-20-31)41-17-13-37(52-41)44(30-5-9-34(10-6-30)55-28-2-23-47)38-14-18-42(53-38)46(32-21-26-49-27-22-32)40-16-12-36(43)51-40/h3-22,24-27,50-53H,2,23,28,47H2,1H3 |
| InChIKey | ZKGIZGSEUUFMHP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|