C16H23N4O4+ — CID 123309118
7,15-dimethyl-1,5,13-triaza-9-azoniatricyclo[11.3.1.15,9]octadec-8-ene-6,16,17,18-tetrone (PubChem CID 123309118) has the molecular formula C16H23N4O4+ and a molecular weight of 335.38 g/mol. Its IUPAC name is 7,15-dimethyl-1,5,13-triaza-9-azoniatricyclo[11.3.1.15,9]octadec-8-ene-6,16,17,18-tetrone.
| Compound Name | 7,15-dimethyl-1,5,13-triaza-9-azoniatricyclo[11.3.1.15,9]octadec-8-ene-6,16,17,18-tetrone |
|---|---|
| PubChem CID | 123309118 |
| Molecular Formula | C16H23N4O4+ |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 7,15-dimethyl-1,5,13-triaza-9-azoniatricyclo[11.3.1.15,9]octadec-8-ene-6,16,17,18-tetrone |
| SMILES | CC1C=[N+]2CCCN3CC(C)C(=O)N(CCCN(C1=O)C2=O)C3=O |
| InChI | InChI=1S/C16H23N4O4/c1-11-9-17-5-3-6-18-10-12(2)14(22)20(16(18)24)8-4-7-19(13(11)21)15(17)23/h9,11-12H,3-8,10H2,1-2H3/q+1 |
| InChIKey | KODXHOLPIAMKBS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|