C69H46N4O — CID 123309250
3-[9-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrodibenzofuran-2-yl]-9-phenylcarbazole (PubChem CID 123309250) has the molecular formula C69H46N4O and a molecular weight of 947.15 g/mol. Its IUPAC name is 3-[9-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrodibenzofuran-2-yl]-9-phenylcarbazole.
| Compound Name | 3-[9-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrodibenzofuran-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 123309250 |
| Molecular Formula | C69H46N4O |
| Molecular Weight | 947.15 g/mol |
| Exact Mass | 946.37 |
| IUPAC Name | 3-[9-[4,6-bis(3,5-diphenylphenyl)-1,3,5-triazin-2-yl]-2,3-dihydrodibenzofuran-2-yl]-9-phenylcarbazole |
| SMILES | C1=c2oc3cccc(-c4nc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)nc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)n4)c3c2=CC(c2ccc3c(c2)c2ccccc2n3-c2ccccc2)C1 |
| InChI | InChI=1S/C69H46N4O/c1-6-19-45(20-7-1)51-37-52(46-21-8-2-9-22-46)40-55(39-51)67-70-68(56-41-53(47-23-10-3-11-24-47)38-54(42-56)48-25-12-4-13-26-48)72-69(71-67)59-30-18-32-65-66(59)61-44-50(34-36-64(61)74-65)49-33-35-63-60(43-49)58-29-16-17-31-62(58)73(63)57-27-14-5-15-28-57/h1-33,35-44,50H,34H2 |
| InChIKey | WAGOYEKQGNXGQU-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.15 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |