About 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine
4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine (PubChem CID 123309603) has the molecular formula C15H25FN2
and a molecular weight of 252.38 g/mol. Its IUPAC name is 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine |
| PubChem CID | 123309603 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine |
| SMILES | C=C(C=C(C)C1CCNCC1)N1CCC(C)(F)C1 |
| InChI | InChI=1S/C15H25FN2/c1-12(14-4-7-17-8-5-14)10-13(2)18-9-6-15(3,16)11-18/h10,14,17H,2,4-9,11H2,1,3H3 |
| InChIKey | LXRGDBVJNSHDMU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine?
The IUPAC name of 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine (CID 123309603) is 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine.
What is the SMILES notation for 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine?
The canonical SMILES for 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine is C=C(C=C(C)C1CCNCC1)N1CCC(C)(F)C1.
What is the InChIKey of 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine?
The InChIKey is LXRGDBVJNSHDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25FN2/c1-12(14-4-7-17-8-5-14)10-13(2)18-9-6-15(3,16)11-18/h10,14,17H,2,4-9,11H2,1,3H3.
What are the key properties of 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine?
4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine has a molecular weight of 252.38 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-fluoro-3-methylpyrrolidin-1-yl)penta-2,4-dien-2-yl]piperidine is sourced from PubChem (CID 123309603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).