C12H25ClO — CID 123309628
1-chloro-5-ethoxy-2,3,3,5-tetramethylhexane (PubChem CID 123309628) has the molecular formula C12H25ClO and a molecular weight of 220.78 g/mol. Its IUPAC name is 1-chloro-5-ethoxy-2,3,3,5-tetramethylhexane.
| Compound Name | 1-chloro-5-ethoxy-2,3,3,5-tetramethylhexane |
|---|---|
| PubChem CID | 123309628 |
| Molecular Formula | C12H25ClO |
| Molecular Weight | 220.78 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-chloro-5-ethoxy-2,3,3,5-tetramethylhexane |
| SMILES | CCOC(C)(C)CC(C)(C)C(C)CCl |
| InChI | InChI=1S/C12H25ClO/c1-7-14-12(5,6)9-11(3,4)10(2)8-13/h10H,7-9H2,1-6H3 |
| InChIKey | XLPMHUWLUNIOLB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|