C28H55ClN6O2 — CID 123309683
3,3-diamino-2-(8-chloro-4,4-dipropylazonan-2-yl)-N-[4-(1-methylpiperidin-3-yl)oxypiperidin-3-yl]propanamide (PubChem CID 123309683) has the molecular formula C28H55ClN6O2 and a molecular weight of 543.24 g/mol. Its IUPAC name is 3,3-diamino-2-(8-chloro-4,4-dipropylazonan-2-yl)-N-[4-(1-methylpiperidin-3-yl)oxypiperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(8-chloro-4,4-dipropylazonan-2-yl)-N-[4-(1-methylpiperidin-3-yl)oxypiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123309683 |
| Molecular Formula | C28H55ClN6O2 |
| Molecular Weight | 543.24 g/mol |
| Exact Mass | 542.41 |
| IUPAC Name | 3,3-diamino-2-(8-chloro-4,4-dipropylazonan-2-yl)-N-[4-(1-methylpiperidin-3-yl)oxypiperidin-3-yl]propanamide |
| SMILES | CCCC1(CCC)CCCC(Cl)CNC(C(C(=O)NC2CNCCC2OC2CCCN(C)C2)C(N)N)C1 |
| InChI | InChI=1S/C28H55ClN6O2/c1-4-11-28(12-5-2)13-6-8-20(29)17-33-22(16-28)25(26(30)31)27(36)34-23-18-32-14-10-24(23)37-21-9-7-15-35(3)19-21/h20-26,32-33H,4-19,30-31H2,1-3H3,(H,34,36) |
| InChIKey | VVVXXMVMEICAGL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|