C16H16FN3 — CID 123309959
1-[(4-fluorophenyl)methyl]-5,7-dimethylindazol-4-amine (PubChem CID 123309959) has the molecular formula C16H16FN3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5,7-dimethylindazol-4-amine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5,7-dimethylindazol-4-amine |
|---|---|
| PubChem CID | 123309959 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5,7-dimethylindazol-4-amine |
| SMILES | Cc1cc(C)c2c(cnn2Cc2ccc(F)cc2)c1N |
| InChI | InChI=1S/C16H16FN3/c1-10-7-11(2)16-14(15(10)18)8-19-20(16)9-12-3-5-13(17)6-4-12/h3-8H,9,18H2,1-2H3 |
| InChIKey | CZJZGGCUUFQOHF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|