About 4-chloro-2-fluoro-3,5,6-trimethylpiperidine
4-chloro-2-fluoro-3,5,6-trimethylpiperidine (PubChem CID 123310058) has the molecular formula C8H15ClFN
and a molecular weight of 179.67 g/mol. Its IUPAC name is 4-chloro-2-fluoro-3,5,6-trimethylpiperidine.
Molecular Properties
| Compound Name | 4-chloro-2-fluoro-3,5,6-trimethylpiperidine |
| PubChem CID | 123310058 |
| Molecular Formula | C8H15ClFN |
| Molecular Weight | 179.67 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-chloro-2-fluoro-3,5,6-trimethylpiperidine |
| SMILES | CC1NC(F)C(C)C(Cl)C1C |
| InChI | InChI=1S/C8H15ClFN/c1-4-6(3)11-8(10)5(2)7(4)9/h4-8,11H,1-3H3 |
| InChIKey | UQJNPVHNGJKUCM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-fluoro-3,5,6-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-fluoro-3,5,6-trimethylpiperidine?
The IUPAC name of 4-chloro-2-fluoro-3,5,6-trimethylpiperidine (CID 123310058) is 4-chloro-2-fluoro-3,5,6-trimethylpiperidine.
What is the SMILES notation for 4-chloro-2-fluoro-3,5,6-trimethylpiperidine?
The canonical SMILES for 4-chloro-2-fluoro-3,5,6-trimethylpiperidine is CC1NC(F)C(C)C(Cl)C1C.
What is the InChIKey of 4-chloro-2-fluoro-3,5,6-trimethylpiperidine?
The InChIKey is UQJNPVHNGJKUCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClFN/c1-4-6(3)11-8(10)5(2)7(4)9/h4-8,11H,1-3H3.
What are the key properties of 4-chloro-2-fluoro-3,5,6-trimethylpiperidine?
4-chloro-2-fluoro-3,5,6-trimethylpiperidine has a molecular weight of 179.67 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-fluoro-3,5,6-trimethylpiperidine is sourced from PubChem (CID 123310058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).