C17H26N5+ — CID 123310194
N-(1-imino-3-methylocta-2,4-dien-4-yl)imino-N',1-dimethyl-2,3-dihydropyridin-1-ium-4-carboximidamide (PubChem CID 123310194) has the molecular formula C17H26N5+ and a molecular weight of 300.43 g/mol. Its IUPAC name is N-(1-imino-3-methylocta-2,4-dien-4-yl)imino-N',1-dimethyl-2,3-dihydropyridin-1-ium-4-carboximidamide.
| Compound Name | N-(1-imino-3-methylocta-2,4-dien-4-yl)imino-N',1-dimethyl-2,3-dihydropyridin-1-ium-4-carboximidamide |
|---|---|
| PubChem CID | 123310194 |
| Molecular Formula | C17H26N5+ |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-(1-imino-3-methylocta-2,4-dien-4-yl)imino-N',1-dimethyl-2,3-dihydropyridin-1-ium-4-carboximidamide |
| SMILES | [H]/N=C/C=C(C)C(=CCCC)/N=N/C(=N\C)C1=CC=[N+](C)CC1 |
| InChI | InChI=1S/C17H26N5/c1-5-6-7-16(14(2)8-11-18)20-21-17(19-3)15-9-12-22(4)13-10-15/h7-9,11-12,18H,5-6,10,13H2,1-4H3/q+1/b14-8?,16-7?,18-11+,19-17-,21-20+ |
| InChIKey | YUYKFHXMXRDFHG-ASVDAZPMSA-N |
| XLogP | 3.79 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|