C48H68N2O4 — CID 123310564
2-[[3-[[1,3-dihydroxy-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindol-2-yl]methyl]phenyl]methyl]-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 123310564) has the molecular formula C48H68N2O4 and a molecular weight of 737.08 g/mol. Its IUPAC name is 2-[[3-[[1,3-dihydroxy-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindol-2-yl]methyl]phenyl]methyl]-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[[3-[[1,3-dihydroxy-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindol-2-yl]methyl]phenyl]methyl]-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 123310564 |
| Molecular Formula | C48H68N2O4 |
| Molecular Weight | 737.08 g/mol |
| Exact Mass | 736.52 |
| IUPAC Name | 2-[[3-[[1,3-dihydroxy-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindol-2-yl]methyl]phenyl]methyl]-5-(2,6,7,7-tetramethyloct-5-en-2-yl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC(=CCCC(C)(C)C1=CCc2c(c(O)n(Cc3cccc(Cn4c(O)c5c(c4O)CC(C(C)(C)CCC=C(C)C(C)(C)C)=CC5)c3)c2O)C1)C(C)(C)C |
| InChI | InChI=1S/C48H68N2O4/c1-31(45(3,4)5)16-14-24-47(9,10)35-20-22-37-39(27-35)43(53)49(41(37)51)29-33-18-13-19-34(26-33)30-50-42(52)38-23-21-36(28-40(38)44(50)54)48(11,12)25-15-17-32(2)46(6,7)8/h13,16-21,26,51-54H,14-15,22-25,27-30H2,1-12H3 |
| InChIKey | YNCZLSDOVOLREI-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.08 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|