C37H40F2N6O+2 — CID 123310890
4-[4-[4-[4-(1,1-difluorobut-3-enyl)-3-ethyl-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]-1-methylpiperidin-1-ium-1-yl]-1-methyl-7H-pyrrolo[2,3-d]pyrimidin-1-ium-6-yl]benzonitrile (PubChem CID 123310890) has the molecular formula C37H40F2N6O+2 and a molecular weight of 622.76 g/mol. Its IUPAC name is 4-[4-[4-[4-(1,1-difluorobut-3-enyl)-3-ethyl-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]-1-methylpiperidin-1-ium-1-yl]-1-methyl-7H-pyrrolo[2,3-d]pyrimidin-1-ium-6-yl]benzonitrile.
| Compound Name | 4-[4-[4-[4-(1,1-difluorobut-3-enyl)-3-ethyl-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]-1-methylpiperidin-1-ium-1-yl]-1-methyl-7H-pyrrolo[2,3-d]pyrimidin-1-ium-6-yl]benzonitrile |
|---|---|
| PubChem CID | 123310890 |
| Molecular Formula | C37H40F2N6O+2 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | 4-[4-[4-[4-(1,1-difluorobut-3-enyl)-3-ethyl-5-(4-methoxyphenyl)-1H-pyrrol-2-yl]-1-methylpiperidin-1-ium-1-yl]-1-methyl-7H-pyrrolo[2,3-d]pyrimidin-1-ium-6-yl]benzonitrile |
| SMILES | C=CCC(F)(F)c1c(-c2ccc(OC)cc2)[nH]c(C2CC[N+](C)(c3nc[n+](C)c4[nH]c(-c5ccc(C#N)cc5)cc34)CC2)c1CC |
| InChI | InChI=1S/C37H39F2N6O/c1-6-18-37(38,39)32-29(7-2)33(43-34(32)26-12-14-28(46-5)15-13-26)27-16-19-45(4,20-17-27)36-30-21-31(42-35(30)44(3)23-41-36)25-10-8-24(22-40)9-11-25/h6,8-15,21,23,27,43H,1,7,16-20H2,2-5H3/q+1/p+1 |
| InChIKey | LYHFCQBOHAHVRR-UHFFFAOYSA-O |
| XLogP | 7.67 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|