C56H67N15O6 — CID 123311520
bis(3-(9-butan-2-yl-8-methyl-2-morpholin-4-ylpurin-6-yl)phenol);3-(8-methyl-2-morpholin-4-yl-7H-purin-6-yl)phenol (PubChem CID 123311520) has the molecular formula C56H67N15O6 and a molecular weight of 1046.25 g/mol. Its IUPAC name is bis(3-(9-butan-2-yl-8-methyl-2-morpholin-4-ylpurin-6-yl)phenol);3-(8-methyl-2-morpholin-4-yl-7H-purin-6-yl)phenol.
| Compound Name | bis(3-(9-butan-2-yl-8-methyl-2-morpholin-4-ylpurin-6-yl)phenol);3-(8-methyl-2-morpholin-4-yl-7H-purin-6-yl)phenol |
|---|---|
| PubChem CID | 123311520 |
| Molecular Formula | C56H67N15O6 |
| Molecular Weight | 1046.25 g/mol |
| Exact Mass | 1045.54 |
| IUPAC Name | bis(3-(9-butan-2-yl-8-methyl-2-morpholin-4-ylpurin-6-yl)phenol);3-(8-methyl-2-morpholin-4-yl-7H-purin-6-yl)phenol |
| SMILES | CCC(C)n1c(C)nc2c(-c3cccc(O)c3)nc(N3CCOCC3)nc21.CCC(C)n1c(C)nc2c(-c3cccc(O)c3)nc(N3CCOCC3)nc21.Cc1nc2nc(N3CCOCC3)nc(-c3cccc(O)c3)c2[nH]1 |
| InChI | InChI=1S/2C20H25N5O2.C16H17N5O2/c2*1-4-13(2)25-14(3)21-18-17(15-6-5-7-16(26)12-15)22-20(23-19(18)25)24-8-10-27-11-9-24;1-10-17-14-13(11-3-2-4-12(22)9-11)19-16(20-15(14)18-10)21-5-7-23-8-6-21/h2*5-7,12-13,26H,4,8-11H2,1-3H3;2-4,9,22H,5-8H2,1H3,(H,17,18,19,20) |
| InChIKey | OUPBGGYQMWEXEZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 239.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1046.25 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |