C9H7ClF3IN4 — CID 123311536
7-chloro-3-iodo-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazin-8-amine (PubChem CID 123311536) has the molecular formula C9H7ClF3IN4 and a molecular weight of 390.53 g/mol. Its IUPAC name is 7-chloro-3-iodo-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazin-8-amine.
| Compound Name | 7-chloro-3-iodo-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazin-8-amine |
|---|---|
| PubChem CID | 123311536 |
| Molecular Formula | C9H7ClF3IN4 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 7-chloro-3-iodo-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazin-8-amine |
| SMILES | FC(F)(F)CCNc1c(Cl)cnn2c(I)cnc12 |
| InChI | InChI=1S/C9H7ClF3IN4/c10-5-3-17-18-6(14)4-16-8(18)7(5)15-2-1-9(11,12)13/h3-4,15H,1-2H2 |
| InChIKey | GAUNJWYNQGCWML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|