About N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide
N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide (PubChem CID 123311571) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide.
Molecular Properties
| Compound Name | N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide |
| PubChem CID | 123311571 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1=CC=CCC1 |
| InChI | InChI=1S/C10H15NO/c1-8(2)10(12)11-9-6-4-3-5-7-9/h3-4,6,8H,5,7H2,1-2H3,(H,11,12) |
| InChIKey | YQKXOSZDOUXORD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide?
The IUPAC name of N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide (CID 123311571) is N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide.
What is the SMILES notation for N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide?
The canonical SMILES for N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide is CC(C)C(=O)NC1=CC=CCC1.
What is the InChIKey of N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide?
The InChIKey is YQKXOSZDOUXORD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-8(2)10(12)11-9-6-4-3-5-7-9/h3-4,6,8H,5,7H2,1-2H3,(H,11,12).
What are the key properties of N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide?
N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide has a molecular weight of 165.24 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,3-dien-1-yl-2-methylpropanamide is sourced from PubChem (CID 123311571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).