About pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate
pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate (PubChem CID 123311647) has the molecular formula C32H40NO2+
and a molecular weight of 470.68 g/mol. Its IUPAC name is pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate.
Molecular Properties
| Compound Name | pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate |
| PubChem CID | 123311647 |
| Molecular Formula | C32H40NO2+ |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate |
| SMILES | CCC1C[N+](C)(C)CC1CCC(C)(CC)C(=O)OCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C32H40NO2/c1-6-22-19-33(4,5)20-26(22)17-18-32(3,7-2)31(34)35-21-27-14-13-25-12-11-23-9-8-10-24-15-16-28(27)30(25)29(23)24/h8-16,22,26H,6-7,17-21H2,1-5H3/q+1 |
| InChIKey | JIVOOWOPNGBFTA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate?
The IUPAC name of pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate (CID 123311647) is pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate.
What is the SMILES notation for pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate?
The canonical SMILES for pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate is CCC1C[N+](C)(C)CC1CCC(C)(CC)C(=O)OCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate?
The InChIKey is JIVOOWOPNGBFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H40NO2/c1-6-22-19-33(4,5)20-26(22)17-18-32(3,7-2)31(34)35-21-27-14-13-25-12-11-23-9-8-10-24-15-16-28(27)30(25)29(23)24/h8-16,22,26H,6-7,17-21H2,1-5H3/q+1.
What are the key properties of pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate?
pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate has a molecular weight of 470.68 g/mol, XLogP of 7.56, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyren-1-ylmethyl 2-ethyl-4-(4-ethyl-1,1-dimethylpyrrolidin-1-ium-3-yl)-2-methylbutanoate is sourced from PubChem (CID 123311647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).