C22H22ClF3N5O2+ — CID 123311955
[1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-methylspiro[2-benzofuran-3,4'-piperidine]-1-yl]-methyl-oxoazanium (PubChem CID 123311955) has the molecular formula C22H22ClF3N5O2+ and a molecular weight of 480.90 g/mol. Its IUPAC name is [1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-methylspiro[2-benzofuran-3,4'-piperidine]-1-yl]-methyl-oxoazanium.
| Compound Name | [1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-methylspiro[2-benzofuran-3,4'-piperidine]-1-yl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 123311955 |
| Molecular Formula | C22H22ClF3N5O2+ |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [1'-[8-chloro-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-methylspiro[2-benzofuran-3,4'-piperidine]-1-yl]-methyl-oxoazanium |
| SMILES | C[N+](=O)C1(C)OC2(CCN(c3ccn4c(CC(F)(F)F)nnc4c3Cl)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H22ClF3N5O2/c1-20(29(2)32)14-5-3-4-6-15(14)21(33-20)8-11-30(12-9-21)16-7-10-31-17(13-22(24,25)26)27-28-19(31)18(16)23/h3-7,10H,8-9,11-13H2,1-2H3/q+1 |
| InChIKey | MWKBIALZXSTFEK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|