C25H28FN7O2 — CID 123312026
1-[4-[[4-(2,5-dimethylmorpholin-4-yl)-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3,5-triazin-2-yl]oxy]-3-fluorophenyl]-N,N-dimethylmethanamine (PubChem CID 123312026) has the molecular formula C25H28FN7O2 and a molecular weight of 477.54 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dimethylmorpholin-4-yl)-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3,5-triazin-2-yl]oxy]-3-fluorophenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[[4-(2,5-dimethylmorpholin-4-yl)-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3,5-triazin-2-yl]oxy]-3-fluorophenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 123312026 |
| Molecular Formula | C25H28FN7O2 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 1-[4-[[4-(2,5-dimethylmorpholin-4-yl)-6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1,3,5-triazin-2-yl]oxy]-3-fluorophenyl]-N,N-dimethylmethanamine |
| SMILES | CC1CN(c2nc(Oc3ccc(CN(C)C)cc3F)nc(-c3cnc4[nH]ccc4c3)n2)C(C)CO1 |
| InChI | InChI=1S/C25H28FN7O2/c1-15-14-34-16(2)12-33(15)24-29-23(19-10-18-7-8-27-22(18)28-11-19)30-25(31-24)35-21-6-5-17(9-20(21)26)13-32(3)4/h5-11,15-16H,12-14H2,1-4H3,(H,27,28) |
| InChIKey | JCFCFVVEQQXWAN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |