C26H26F2O3 — CID 123312251
(1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(3,5-difluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123312251) has the molecular formula C26H26F2O3 and a molecular weight of 424.49 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(3,5-difluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(3,5-difluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123312251 |
| Molecular Formula | C26H26F2O3 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(3,5-difluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@@H]2[C@@H]3O[C@@H](C[C@H]3c3cc(F)cc(F)c3)[C@@H]2C1=O |
| InChI | InChI=1S/C26H26F2O3/c1-4-13-6-12(3)7-14(5-2)20(13)22-24(29)21-19-11-18(26(31-19)23(21)25(22)30)15-8-16(27)10-17(28)9-15/h6-10,18-19,21-23,26H,4-5,11H2,1-3H3/t18-,19-,21-,22?,23+,26+/m0/s1 |
| InChIKey | PSURVWVRTPBYQA-JOOPMAATSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|