C12H19N3O3 — CID 123312494
ethyl (Z,3E)-3-(acetylhydrazinylidene)-4-(ethylideneamino)hex-4-enoate (PubChem CID 123312494) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl (Z,3E)-3-(acetylhydrazinylidene)-4-(ethylideneamino)hex-4-enoate.
| Compound Name | ethyl (Z,3E)-3-(acetylhydrazinylidene)-4-(ethylideneamino)hex-4-enoate |
|---|---|
| PubChem CID | 123312494 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | ethyl (Z,3E)-3-(acetylhydrazinylidene)-4-(ethylideneamino)hex-4-enoate |
| SMILES | C/C=C(\N=C\C)C(/CC(=O)OCC)=N/NC(C)=O |
| InChI | InChI=1S/C12H19N3O3/c1-5-10(13-6-2)11(15-14-9(4)16)8-12(17)18-7-3/h5-6H,7-8H2,1-4H3,(H,14,16)/b10-5-,13-6+,15-11+ |
| InChIKey | RKZCBGQVEDCYSC-SOMZHVAFSA-N |
| XLogP | 1.43 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|