C11H10N2 — CID 123312557
1-hexa-3,5-dien-1-yn-3-yl-6-methylidenepyridazine (PubChem CID 123312557) has the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-hexa-3,5-dien-1-yn-3-yl-6-methylidenepyridazine.
| Compound Name | 1-hexa-3,5-dien-1-yn-3-yl-6-methylidenepyridazine |
|---|---|
| PubChem CID | 123312557 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-hexa-3,5-dien-1-yn-3-yl-6-methylidenepyridazine |
| SMILES | C#CC(=CC=C)N1N=CC=CC1=C |
| InChI | InChI=1S/C11H10N2/c1-4-7-11(5-2)13-10(3)8-6-9-12-13/h2,4,6-9H,1,3H2 |
| InChIKey | VGKATVPIMIFVCO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|