C24H13BrN6O2 — CID 123312597
N-[4-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,2,4-triazol-3-yl]-4-bromocyclohex-2-en-5-yn-1-imine (PubChem CID 123312597) has the molecular formula C24H13BrN6O2 and a molecular weight of 497.31 g/mol. Its IUPAC name is N-[4-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,2,4-triazol-3-yl]-4-bromocyclohex-2-en-5-yn-1-imine.
| Compound Name | N-[4-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,2,4-triazol-3-yl]-4-bromocyclohex-2-en-5-yn-1-imine |
|---|---|
| PubChem CID | 123312597 |
| Molecular Formula | C24H13BrN6O2 |
| Molecular Weight | 497.31 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | N-[4-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,2,4-triazol-3-yl]-4-bromocyclohex-2-en-5-yn-1-imine |
| SMILES | BrC1C#CC(=Nc2nncn2-c2ccc3nc(-c4ccco4)c(-c4ccco4)nc3c2)C=C1 |
| InChI | InChI=1S/C24H13BrN6O2/c25-15-5-7-16(8-6-15)27-24-30-26-14-31(24)17-9-10-18-19(13-17)29-23(21-4-2-12-33-21)22(28-18)20-3-1-11-32-20/h1-5,7,9-15H |
| InChIKey | YYOHIVYZRKVOAD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|