About 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one
8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one (PubChem CID 123313223) has the molecular formula C29H37N3O2
and a molecular weight of 459.63 g/mol. Its IUPAC name is 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one |
| PubChem CID | 123313223 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one |
| SMILES | CC(C)C1CCCC(c2cc3cc[nH]c(=O)c3c(Nc3ccc(C4CCOCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C29H37N3O2/c1-19(2)20-4-3-5-23(7-6-20)26-18-24-12-15-30-29(33)27(24)28(32-26)31-25-10-8-21(9-11-25)22-13-16-34-17-14-22/h8-12,15,18-20,22-23H,3-7,13-14,16-17H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | BITHTJUSRZFOGC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one?
The IUPAC name of 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one (CID 123313223) is 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one is CC(C)C1CCCC(c2cc3cc[nH]c(=O)c3c(Nc3ccc(C4CCOCC4)cc3)n2)CC1.
What is the InChIKey of 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one?
The InChIKey is BITHTJUSRZFOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H37N3O2/c1-19(2)20-4-3-5-23(7-6-20)26-18-24-12-15-30-29(33)27(24)28(32-26)31-25-10-8-21(9-11-25)22-13-16-34-17-14-22/h8-12,15,18-20,22-23H,3-7,13-14,16-17H2,1-2H3,(H,30,33)(H,31,32).
What are the key properties of 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one?
8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one has a molecular weight of 459.63 g/mol, XLogP of 6.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(oxan-4-yl)anilino]-6-(4-propan-2-ylcycloheptyl)-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 123313223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).