C25H33N3O3S — CID 123313250
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-2-sulfanylbutyl]-3-(oxan-4-ylamino)benzamide (PubChem CID 123313250) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-2-sulfanylbutyl]-3-(oxan-4-ylamino)benzamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-2-sulfanylbutyl]-3-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 123313250 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-hydroxy-2-sulfanylbutyl]-3-(oxan-4-ylamino)benzamide |
| SMILES | O=C(NCC(S)C(O)CN1CCc2ccccc2C1)c1cccc(NC2CCOCC2)c1 |
| InChI | InChI=1S/C25H33N3O3S/c29-23(17-28-11-8-18-4-1-2-5-20(18)16-28)24(32)15-26-25(30)19-6-3-7-22(14-19)27-21-9-12-31-13-10-21/h1-7,14,21,23-24,27,29,32H,8-13,15-17H2,(H,26,30) |
| InChIKey | AEZHNVKNTHNWCG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|