C24H43NO13S — CID 123313351
2-[2-[2-[2-[[4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 123313351) has the molecular formula C24H43NO13S and a molecular weight of 585.67 g/mol. Its IUPAC name is 2-[2-[2-[2-[[4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[[4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 123313351 |
| Molecular Formula | C24H43NO13S |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 2-[2-[2-[2-[[4,4-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1C2OCC(COCCOCCOCCOCCOS(C)(=O)=O)(O2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C24H43NO13S/c1-22(2,3)38-21(26)25-17-18-19(36-23(4,5)35-18)24(16-33-20(17)37-24)15-32-12-11-30-8-7-29-9-10-31-13-14-34-39(6,27)28/h17-20H,7-16H2,1-6H3,(H,25,26) |
| InChIKey | OASFLWAEGUIKLI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|