C26H51FN7O+ — CID 123313529
3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-(4-ethylpiperazin-1-yl)piperidin-3-yl]propanamide (PubChem CID 123313529) has the molecular formula C26H51FN7O+ and a molecular weight of 496.74 g/mol. Its IUPAC name is 3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-(4-ethylpiperazin-1-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-(4-ethylpiperazin-1-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123313529 |
| Molecular Formula | C26H51FN7O+ |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.41 |
| IUPAC Name | 3,3-diamino-2-(4-ethyl-8-fluoro-1,4-dimethyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-(4-ethylpiperazin-1-yl)piperidin-3-yl]propanamide |
| SMILES | CCN1CCN(C2CCNCC2NC(=O)C(C(N)N)C2CC(C)(CC)CCCC(F)/C=[N+]\2C)CC1 |
| InChI | InChI=1S/C26H50FN7O/c1-5-26(3)10-7-8-19(27)18-32(4)22(16-26)23(24(28)29)25(35)31-20-17-30-11-9-21(20)34-14-12-33(6-2)13-15-34/h18-24,30H,5-17,28-29H2,1-4H3/p+1/b32-18- |
| InChIKey | HNDIBSIQKGKVFX-CAQPMQTCSA-O |
| XLogP | 0.74 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|