About (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine
(2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine (PubChem CID 123313856) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine.
Analyze (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine?
The IUPAC name of (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine (CID 123313856) is (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine.
What is the SMILES notation for (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine?
The canonical SMILES for (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine is NCC1CC=CC(F)=C1F.
What is the InChIKey of (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine?
The InChIKey is MEMKISRWHOSMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N/c8-6-3-1-2-5(4-10)7(6)9/h1,3,5H,2,4,10H2.
What are the key properties of (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine?
(2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine has a molecular weight of 145.15 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluorocyclohexa-2,4-dien-1-yl)methanamine is sourced from PubChem (CID 123313856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).