C30H47N7O6 — CID 123313980
tert-butyl 4-[3-hydrazinyl-2-[[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]-3-phenylpropanoyl]amino]-3-oxopropyl]imidazole-1-carboxylate (PubChem CID 123313980) has the molecular formula C30H47N7O6 and a molecular weight of 601.75 g/mol. Its IUPAC name is tert-butyl 4-[3-hydrazinyl-2-[[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]-3-phenylpropanoyl]amino]-3-oxopropyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[3-hydrazinyl-2-[[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]-3-phenylpropanoyl]amino]-3-oxopropyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 123313980 |
| Molecular Formula | C30H47N7O6 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | tert-butyl 4-[3-hydrazinyl-2-[[2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]-3-phenylpropanoyl]amino]-3-oxopropyl]imidazole-1-carboxylate |
| SMILES | CC(C)C(CNC(Cc1ccccc1)C(=O)NC(Cc1cn(C(=O)OC(C)(C)C)cn1)C(=O)NN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47N7O6/c1-19(2)24(35-27(40)42-29(3,4)5)16-32-22(14-20-12-10-9-11-13-20)25(38)34-23(26(39)36-31)15-21-17-37(18-33-21)28(41)43-30(6,7)8/h9-13,17-19,22-24,32H,14-16,31H2,1-8H3,(H,34,38)(H,35,40)(H,36,39) |
| InChIKey | YPKUTNQNOYIFPU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 178.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|