C25H32N2O4 — CID 123314292
methyl 2-[[3-phenyl-2-(6-phenylhexanoylamino)propanoyl]amino]propanoate (PubChem CID 123314292) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is methyl 2-[[3-phenyl-2-(6-phenylhexanoylamino)propanoyl]amino]propanoate.
| Compound Name | methyl 2-[[3-phenyl-2-(6-phenylhexanoylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 123314292 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | methyl 2-[[3-phenyl-2-(6-phenylhexanoylamino)propanoyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)C(Cc1ccccc1)NC(=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C25H32N2O4/c1-19(25(30)31-2)26-24(29)22(18-21-15-9-4-10-16-21)27-23(28)17-11-5-8-14-20-12-6-3-7-13-20/h3-4,6-7,9-10,12-13,15-16,19,22H,5,8,11,14,17-18H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | SRVFNEXCEQPAQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|