C26H37N5 — CID 123314455
N'-[4-[(6-cyclohexa-1,5-dien-1-ylimino-4-imino-3-methylcyclohex-2-en-1-ylidene)amino]-6-methylcyclohexa-2,4-dien-1-yl]hexane-1,6-diamine (PubChem CID 123314455) has the molecular formula C26H37N5 and a molecular weight of 419.62 g/mol. Its IUPAC name is N'-[4-[(6-cyclohexa-1,5-dien-1-ylimino-4-imino-3-methylcyclohex-2-en-1-ylidene)amino]-6-methylcyclohexa-2,4-dien-1-yl]hexane-1,6-diamine.
| Compound Name | N'-[4-[(6-cyclohexa-1,5-dien-1-ylimino-4-imino-3-methylcyclohex-2-en-1-ylidene)amino]-6-methylcyclohexa-2,4-dien-1-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 123314455 |
| Molecular Formula | C26H37N5 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | N'-[4-[(6-cyclohexa-1,5-dien-1-ylimino-4-imino-3-methylcyclohex-2-en-1-ylidene)amino]-6-methylcyclohexa-2,4-dien-1-yl]hexane-1,6-diamine |
| SMILES | [H]/N=C1/CC(=N\C2=CCCC=C2)/C(=N/C2=CC(C)C(NCCCCCCN)C=C2)C=C1C |
| InChI | InChI=1S/C26H37N5/c1-19-17-25(26(18-23(19)28)30-21-10-6-5-7-11-21)31-22-12-13-24(20(2)16-22)29-15-9-4-3-8-14-27/h6,10-13,16-17,20,24,28-29H,3-5,7-9,14-15,18,27H2,1-2H3/b28-23-,30-26+,31-25+ |
| InChIKey | URNPSPTVKFZQPW-CXCSXFEXSA-N |
| XLogP | 5.04 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|