C25H33B2N3O3 — CID 123314889
methyl-[(3S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.2]octan-2-yl]borinic acid (PubChem CID 123314889) has the molecular formula C25H33B2N3O3 and a molecular weight of 445.18 g/mol. Its IUPAC name is methyl-[(3S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.2]octan-2-yl]borinic acid.
| Compound Name | methyl-[(3S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.2]octan-2-yl]borinic acid |
|---|---|
| PubChem CID | 123314889 |
| Molecular Formula | C25H33B2N3O3 |
| Molecular Weight | 445.18 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | methyl-[(3S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.2]octan-2-yl]borinic acid |
| SMILES | CB(O)N1C2CCC(CC2)[C@H]1c1nc2c(ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)[nH]1 |
| InChI | InChI=1S/C25H33B2N3O3/c1-24(2)25(3,4)33-27(32-24)17-9-12-19-16(14-17)8-13-20-21(19)29-23(28-20)22-15-6-10-18(11-7-15)30(22)26(5)31/h8-9,12-15,18,22,31H,6-7,10-11H2,1-5H3,(H,28,29)/t15?,18?,22-/m0/s1 |
| InChIKey | BBZWWTIVPCJJKU-URWDPPFZSA-N |
| XLogP | 4.04 |
| TPSA | 70.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|