About 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane
2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane (PubChem CID 123314990) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane.
Molecular Properties
| Compound Name | 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane |
| PubChem CID | 123314990 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane |
| SMILES | CCCC1(C)C(C)CCC2C(C)C13CC23 |
| InChI | InChI=1S/C15H26/c1-5-8-14(4)10(2)6-7-12-11(3)15(14)9-13(12)15/h10-13H,5-9H2,1-4H3 |
| InChIKey | ASYQPPIRNOKLNA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane?
The IUPAC name of 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane (CID 123314990) is 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane.
What is the SMILES notation for 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane?
The canonical SMILES for 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane is CCCC1(C)C(C)CCC2C(C)C13CC23.
What is the InChIKey of 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane?
The InChIKey is ASYQPPIRNOKLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26/c1-5-8-14(4)10(2)6-7-12-11(3)15(14)9-13(12)15/h10-13H,5-9H2,1-4H3.
What are the key properties of 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane?
2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane has a molecular weight of 206.37 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,9-trimethyl-2-propyltricyclo[4.2.1.01,7]nonane is sourced from PubChem (CID 123314990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).