About 2-dec-9-enoxyethyl sulfate
2-dec-9-enoxyethyl sulfate (PubChem CID 123315004) has the molecular formula C12H23O5S-
and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-dec-9-enoxyethyl sulfate.
Molecular Properties
| Compound Name | 2-dec-9-enoxyethyl sulfate |
| PubChem CID | 123315004 |
| Molecular Formula | C12H23O5S- |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-dec-9-enoxyethyl sulfate |
| SMILES | C=CCCCCCCCCOCCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H24O5S/c1-2-3-4-5-6-7-8-9-10-16-11-12-17-18(13,14)15/h2H,1,3-12H2,(H,13,14,15)/p-1 |
| InChIKey | PUJFREUYGVFZIQ-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 2-dec-9-enoxyethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dec-9-enoxyethyl sulfate?
The IUPAC name of 2-dec-9-enoxyethyl sulfate (CID 123315004) is 2-dec-9-enoxyethyl sulfate.
What is the SMILES notation for 2-dec-9-enoxyethyl sulfate?
The canonical SMILES for 2-dec-9-enoxyethyl sulfate is C=CCCCCCCCCOCCOS(=O)(=O)[O-].
What is the InChIKey of 2-dec-9-enoxyethyl sulfate?
The InChIKey is PUJFREUYGVFZIQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24O5S/c1-2-3-4-5-6-7-8-9-10-16-11-12-17-18(13,14)15/h2H,1,3-12H2,(H,13,14,15)/p-1.
What are the key properties of 2-dec-9-enoxyethyl sulfate?
2-dec-9-enoxyethyl sulfate has a molecular weight of 279.38 g/mol, XLogP of 2.40, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dec-9-enoxyethyl sulfate is sourced from PubChem (CID 123315004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).