About 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol
5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol (PubChem CID 123315092) has the molecular formula C8H15F2NO3
and a molecular weight of 211.21 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol |
| PubChem CID | 123315092 |
| Molecular Formula | C8H15F2NO3 |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol |
| SMILES | CC(O)N1CC(O)C(O)C(C(F)F)C1 |
| InChI | InChI=1S/C8H15F2NO3/c1-4(12)11-2-5(8(9)10)7(14)6(13)3-11/h4-8,12-14H,2-3H2,1H3 |
| InChIKey | SPTYXAGASFYNAL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol?
The IUPAC name of 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol (CID 123315092) is 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol.
What is the SMILES notation for 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol?
The canonical SMILES for 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol is CC(O)N1CC(O)C(O)C(C(F)F)C1.
What is the InChIKey of 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol?
The InChIKey is SPTYXAGASFYNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO3/c1-4(12)11-2-5(8(9)10)7(14)6(13)3-11/h4-8,12-14H,2-3H2,1H3.
What are the key properties of 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol?
5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol has a molecular weight of 211.21 g/mol, XLogP of -0.76, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-1-(1-hydroxyethyl)piperidine-3,4-diol is sourced from PubChem (CID 123315092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).