C34H49N2+ — CID 123315404
21-ethenyl-3,8,21-triethyl-5,23-dimethyl-19-propan-2-yl-5-aza-8-azoniahexacyclo[11.8.1.114,20.01,3.04,8.09,22]tricosa-6,9,11,13(22),16-pentaene (PubChem CID 123315404) has the molecular formula C34H49N2+ and a molecular weight of 485.78 g/mol. Its IUPAC name is 21-ethenyl-3,8,21-triethyl-5,23-dimethyl-19-propan-2-yl-5-aza-8-azoniahexacyclo[11.8.1.114,20.01,3.04,8.09,22]tricosa-6,9,11,13(22),16-pentaene.
| Compound Name | 21-ethenyl-3,8,21-triethyl-5,23-dimethyl-19-propan-2-yl-5-aza-8-azoniahexacyclo[11.8.1.114,20.01,3.04,8.09,22]tricosa-6,9,11,13(22),16-pentaene |
|---|---|
| PubChem CID | 123315404 |
| Molecular Formula | C34H49N2+ |
| Molecular Weight | 485.78 g/mol |
| Exact Mass | 485.39 |
| IUPAC Name | 21-ethenyl-3,8,21-triethyl-5,23-dimethyl-19-propan-2-yl-5-aza-8-azoniahexacyclo[11.8.1.114,20.01,3.04,8.09,22]tricosa-6,9,11,13(22),16-pentaene |
| SMILES | C=CC1(CC)C2C(C)C(CC=CCC2C(C)C)c2cccc3c2C12CC2(CC)C1N(C)C=C[N+]31CC |
| InChI | InChI=1S/C34H49N2/c1-9-32(10-2)29-24(7)26(17-14-13-16-25(29)23(5)6)27-18-15-19-28-30(27)34(32)22-33(34,11-3)31-35(8)20-21-36(28,31)12-4/h9,13-15,18-21,23-26,29,31H,1,10-12,16-17,22H2,2-8H3/q+1 |
| InChIKey | OXIGHEXGOLLZFE-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.78 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|