C39H58BrN7O4Si2 — CID 123316640
tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate (PubChem CID 123316640) has the molecular formula C39H58BrN7O4Si2 and a molecular weight of 825.01 g/mol. Its IUPAC name is tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123316640 |
| Molecular Formula | C39H58BrN7O4Si2 |
| Molecular Weight | 825.01 g/mol |
| Exact Mass | 823.33 |
| IUPAC Name | tert-butyl 4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C39H58BrN7O4Si2/c1-39(2,3)51-38(48)45-19-17-31(18-20-45)43-35-34(40)37(46(27-49-21-23-52(4,5)6)28-50-22-24-53(7,8)9)47-36(44-35)32(26-42-47)30-15-16-33(41-25-30)29-13-11-10-12-14-29/h10-16,25-26,31H,17-24,27-28H2,1-9H3,(H,43,44) |
| InChIKey | QFCPFRADVUFPOZ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.01 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|