About N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide
N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide (PubChem CID 123316823) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide |
| PubChem CID | 123316823 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide |
| SMILES | C=C/C=C\N/C(C)=N/C |
| InChI | InChI=1S/C7H12N2/c1-4-5-6-9-7(2)8-3/h4-6H,1H2,2-3H3,(H,8,9)/b6-5- |
| InChIKey | ZZYFQYSUHXRGNQ-WAYWQWQTSA-N |
| XLogP | 1.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide?
The IUPAC name of N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide (CID 123316823) is N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide.
What is the SMILES notation for N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide?
The canonical SMILES for N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide is C=C/C=C\N/C(C)=N/C.
What is the InChIKey of N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide?
The InChIKey is ZZYFQYSUHXRGNQ-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-5-6-9-7(2)8-3/h4-6H,1H2,2-3H3,(H,8,9)/b6-5-.
What are the key properties of N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide?
N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide has a molecular weight of 124.19 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-buta-1,3-dienyl]-N'-methylethanimidamide is sourced from PubChem (CID 123316823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).