C19H18FNO5 — CID 123316954
methyl 4-(2-fluoro-3-hydroxyphenyl)-3-phenylmethoxycarbonyliminobutanoate (PubChem CID 123316954) has the molecular formula C19H18FNO5 and a molecular weight of 359.35 g/mol. Its IUPAC name is methyl 4-(2-fluoro-3-hydroxyphenyl)-3-phenylmethoxycarbonyliminobutanoate.
| Compound Name | methyl 4-(2-fluoro-3-hydroxyphenyl)-3-phenylmethoxycarbonyliminobutanoate |
|---|---|
| PubChem CID | 123316954 |
| Molecular Formula | C19H18FNO5 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 4-(2-fluoro-3-hydroxyphenyl)-3-phenylmethoxycarbonyliminobutanoate |
| SMILES | COC(=O)CC(Cc1cccc(O)c1F)=NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18FNO5/c1-25-17(23)11-15(10-14-8-5-9-16(22)18(14)20)21-19(24)26-12-13-6-3-2-4-7-13/h2-9,22H,10-12H2,1H3 |
| InChIKey | MDRNCUWKEZUSHC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|