C29H43NO4 — CID 123316972
[2-[2-[4-(4-ethyl-2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]-5-methyl-3-(nitrosomethyl)phenyl]methanol (PubChem CID 123316972) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is [2-[2-[4-(4-ethyl-2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]-5-methyl-3-(nitrosomethyl)phenyl]methanol.
| Compound Name | [2-[2-[4-(4-ethyl-2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]-5-methyl-3-(nitrosomethyl)phenyl]methanol |
|---|---|
| PubChem CID | 123316972 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | [2-[2-[4-(4-ethyl-2,2,5,5-tetramethylhexan-3-yl)phenoxy]ethoxy]-5-methyl-3-(nitrosomethyl)phenyl]methanol |
| SMILES | CCC(C(c1ccc(OCCOc2c(CO)cc(C)cc2CN=O)cc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H43NO4/c1-9-25(28(3,4)5)26(29(6,7)8)21-10-12-24(13-11-21)33-14-15-34-27-22(18-30-32)16-20(2)17-23(27)19-31/h10-13,16-17,25-26,31H,9,14-15,18-19H2,1-8H3 |
| InChIKey | FKOYOCNQQKTVQE-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|