C18H16O — CID 123317264
11-ethenyl-13-ethylidene-12-methyl-10-oxatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene (PubChem CID 123317264) has the molecular formula C18H16O and a molecular weight of 248.32 g/mol. Its IUPAC name is 11-ethenyl-13-ethylidene-12-methyl-10-oxatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene.
| Compound Name | 11-ethenyl-13-ethylidene-12-methyl-10-oxatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene |
|---|---|
| PubChem CID | 123317264 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 11-ethenyl-13-ethylidene-12-methyl-10-oxatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8,11-hexaene |
| SMILES | C=Cc1oc2cccc3cccc(c(=CC)c1C)c32 |
| InChI | InChI=1S/C18H16O/c1-4-14-12(3)16(5-2)19-17-11-7-9-13-8-6-10-15(14)18(13)17/h4-11H,2H2,1,3H3 |
| InChIKey | STWRYZAYIWKWFS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |