C29H30ClFN8O3 — CID 123317639
carbamoyl 6-(5-chloro-3-pyridinyl)-7-[(4-ethylcyclohexyl)methyl]-8-(4-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-yl)purine-2-carboximidate (PubChem CID 123317639) has the molecular formula C29H30ClFN8O3 and a molecular weight of 593.06 g/mol. Its IUPAC name is carbamoyl 6-(5-chloro-3-pyridinyl)-7-[(4-ethylcyclohexyl)methyl]-8-(4-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-yl)purine-2-carboximidate.
| Compound Name | carbamoyl 6-(5-chloro-3-pyridinyl)-7-[(4-ethylcyclohexyl)methyl]-8-(4-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-yl)purine-2-carboximidate |
|---|---|
| PubChem CID | 123317639 |
| Molecular Formula | C29H30ClFN8O3 |
| Molecular Weight | 593.06 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | carbamoyl 6-(5-chloro-3-pyridinyl)-7-[(4-ethylcyclohexyl)methyl]-8-(4-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-yl)purine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(-c2cncc(Cl)c2)c2c(n1)nc(C1(F)CCOc3cccnc31)n2CC1CCC(CC)CC1 |
| InChI | InChI=1S/C29H30ClFN8O3/c1-2-16-5-7-17(8-6-16)15-39-22-21(18-12-19(30)14-34-13-18)36-26(24(32)42-28(33)40)37-25(22)38-27(39)29(31)9-11-41-20-4-3-10-35-23(20)29/h3-4,10,12-14,16-17,32H,2,5-9,11,15H2,1H3,(H2,33,40)/b32-24- |
| InChIKey | AKBKSKYAJRTUIG-TZHWMEPESA-N |
| XLogP | 5.57 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|