C23H24N4O8 — CID 123317694
14-[(2-formamidoacetyl)-methylamino]-3,18-dihydroxy-10,13-dioxo-9,12-diazatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylic acid (PubChem CID 123317694) has the molecular formula C23H24N4O8 and a molecular weight of 484.47 g/mol. Its IUPAC name is 14-[(2-formamidoacetyl)-methylamino]-3,18-dihydroxy-10,13-dioxo-9,12-diazatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylic acid.
| Compound Name | 14-[(2-formamidoacetyl)-methylamino]-3,18-dihydroxy-10,13-dioxo-9,12-diazatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylic acid |
|---|---|
| PubChem CID | 123317694 |
| Molecular Formula | C23H24N4O8 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 14-[(2-formamidoacetyl)-methylamino]-3,18-dihydroxy-10,13-dioxo-9,12-diazatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylic acid |
| SMILES | CN(C(=O)CNC=O)C1C(=O)NCC(=O)NC(C(=O)O)Cc2ccc(O)c(c2)-c2cc1ccc2O |
| InChI | InChI=1S/C23H24N4O8/c1-27(20(32)10-24-11-28)21-13-3-5-18(30)15(8-13)14-6-12(2-4-17(14)29)7-16(23(34)35)26-19(31)9-25-22(21)33/h2-6,8,11,16,21,29-30H,7,9-10H2,1H3,(H,24,28)(H,25,33)(H,26,31)(H,34,35) |
| InChIKey | FVQVCXQWIYENAQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|