About 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine
6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine (PubChem CID 123318235) has the molecular formula C20H25N7
and a molecular weight of 363.47 g/mol. Its IUPAC name is 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine.
Molecular Properties
| Compound Name | 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine |
| PubChem CID | 123318235 |
| Molecular Formula | C20H25N7 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine |
| SMILES | CCc1nc2c(N3CCC(N4CNc5ccccc54)CC3)ncnc2n1C |
| InChI | InChI=1S/C20H25N7/c1-3-17-24-18-19(25(17)2)21-12-22-20(18)26-10-8-14(9-11-26)27-13-23-15-6-4-5-7-16(15)27/h4-7,12,14,23H,3,8-11,13H2,1-2H3 |
| InChIKey | CXTHEEUHNOZGCO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine?
The IUPAC name of 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine (CID 123318235) is 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine.
What is the SMILES notation for 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine?
The canonical SMILES for 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine is CCc1nc2c(N3CCC(N4CNc5ccccc54)CC3)ncnc2n1C.
What is the InChIKey of 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine?
The InChIKey is CXTHEEUHNOZGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N7/c1-3-17-24-18-19(25(17)2)21-12-22-20(18)26-10-8-14(9-11-26)27-13-23-15-6-4-5-7-16(15)27/h4-7,12,14,23H,3,8-11,13H2,1-2H3.
What are the key properties of 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine?
6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine has a molecular weight of 363.47 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,3-dihydrobenzimidazol-1-yl)piperidin-1-yl]-8-ethyl-9-methylpurine is sourced from PubChem (CID 123318235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).