C24H23ClF3N5O4 — CID 123318322
7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione (PubChem CID 123318322) has the molecular formula C24H23ClF3N5O4 and a molecular weight of 537.93 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione |
|---|---|
| PubChem CID | 123318322 |
| Molecular Formula | C24H23ClF3N5O4 |
| Molecular Weight | 537.93 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-(3-methoxypropyl)-3-methyl-8-[3-(trifluoromethoxy)anilino]purine-2,6-dione |
| SMILES | COCCCn1c(=O)c2c(nc(Nc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C24H23ClF3N5O4/c1-31-20-19(21(34)32(23(31)35)11-4-12-36-2)33(14-15-7-9-16(25)10-8-15)22(30-20)29-17-5-3-6-18(13-17)37-24(26,27)28/h3,5-10,13H,4,11-12,14H2,1-2H3,(H,29,30) |
| InChIKey | DVBKVJGGBBNZDX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|